C8H12N4S2 — CID 54184838
6-(cyclopentylamino)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 54184838) has the molecular formula C8H12N4S2 and a molecular weight of 228.35 g/mol. Its IUPAC name is 6-(cyclopentylamino)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(cyclopentylamino)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 54184838 |
| Molecular Formula | C8H12N4S2 |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 6-(cyclopentylamino)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | S=c1nc(NC2CCCC2)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C8H12N4S2/c13-7-10-6(11-8(14)12-7)9-5-3-1-2-4-5/h5H,1-4H2,(H3,9,10,11,12,13,14) |
| InChIKey | PEJLGZZMOUWIAN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|