C15H21NS — CID 54185531
(1R,9R,10R)-6-thia-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4-diene (PubChem CID 54185531) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is (1R,9R,10R)-6-thia-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4-diene.
| Compound Name | (1R,9R,10R)-6-thia-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4-diene |
|---|---|
| PubChem CID | 54185531 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (1R,9R,10R)-6-thia-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4-diene |
| SMILES | C1=CSC2C[C@H]3NCC[C@@]4(CCCC[C@@H]34)C2=C1 |
| InChI | InChI=1S/C15H21NS/c1-2-6-15-7-8-16-13(11(15)4-1)10-14-12(15)5-3-9-17-14/h3,5,9,11,13-14,16H,1-2,4,6-8,10H2/t11-,13+,14?,15+/m0/s1 |
| InChIKey | PEVBVWDLGKITIS-XNSVHDKESA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |