C18H32O3 — CID 54185574
2,5-bis[1-(oxolan-2-yl)propan-2-yl]oxolane (PubChem CID 54185574) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 2,5-bis[1-(oxolan-2-yl)propan-2-yl]oxolane.
| Compound Name | 2,5-bis[1-(oxolan-2-yl)propan-2-yl]oxolane |
|---|---|
| PubChem CID | 54185574 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 2,5-bis[1-(oxolan-2-yl)propan-2-yl]oxolane |
| SMILES | CC(CC1CCCO1)C1CCC(C(C)CC2CCCO2)O1 |
| InChI | InChI=1S/C18H32O3/c1-13(11-15-5-3-9-19-15)17-7-8-18(21-17)14(2)12-16-6-4-10-20-16/h13-18H,3-12H2,1-2H3 |
| InChIKey | PEVVMSRRRUOBRJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |