4-naphthalen-1-yloxybenzoyl fluoride

C17H11FO2 — CID 54185707

IUPAC4-naphthalen-1-yloxybenzoyl fluoride
SMILESO=C(F)c1ccc(Oc2cccc3ccccc23)cc1
InChIInChI=1S/C17H11FO2/c18-17(19)13-8-10-14(11-9-13)20-16-7-3-5-12-4-1-2-6-15(12)16/h1-11H
InChIKeyPEYCSPYVAQDLDR-UHFFFAOYSA-N
MW266.27 g/mol
LogP4.74
Rot. Bonds3

About 4-naphthalen-1-yloxybenzoyl fluoride

4-naphthalen-1-yloxybenzoyl fluoride (PubChem CID 54185707) has the molecular formula C17H11FO2 and a molecular weight of 266.27 g/mol. Its IUPAC name is 4-naphthalen-1-yloxybenzoyl fluoride.

Molecular Properties

Compound Name4-naphthalen-1-yloxybenzoyl fluoride
PubChem CID54185707
Molecular FormulaC17H11FO2
Molecular Weight266.27 g/mol
Exact Mass266.07
IUPAC Name4-naphthalen-1-yloxybenzoyl fluoride
SMILESO=C(F)c1ccc(Oc2cccc3ccccc23)cc1
InChIInChI=1S/C17H11FO2/c18-17(19)13-8-10-14(11-9-13)20-16-7-3-5-12-4-1-2-6-15(12)16/h1-11H
InChIKeyPEYCSPYVAQDLDR-UHFFFAOYSA-N
XLogP4.74
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.27
LogP ≤ 54.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-naphthalen-1-yloxybenzoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-naphthalen-1-yloxybenzoyl fluoride?
The IUPAC name of 4-naphthalen-1-yloxybenzoyl fluoride (CID 54185707) is 4-naphthalen-1-yloxybenzoyl fluoride.
What is the SMILES notation for 4-naphthalen-1-yloxybenzoyl fluoride?
The canonical SMILES for 4-naphthalen-1-yloxybenzoyl fluoride is O=C(F)c1ccc(Oc2cccc3ccccc23)cc1.
What is the InChIKey of 4-naphthalen-1-yloxybenzoyl fluoride?
The InChIKey is PEYCSPYVAQDLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FO2/c18-17(19)13-8-10-14(11-9-13)20-16-7-3-5-12-4-1-2-6-15(12)16/h1-11H.
What are the key properties of 4-naphthalen-1-yloxybenzoyl fluoride?
4-naphthalen-1-yloxybenzoyl fluoride has a molecular weight of 266.27 g/mol, XLogP of 4.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-naphthalen-1-yloxybenzoyl fluoride is sourced from PubChem (CID 54185707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).