C26H29N3O2 — CID 54185766
5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[2,6-dihydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol (PubChem CID 54185766) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[2,6-dihydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol.
| Compound Name | 5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[2,6-dihydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol |
|---|---|
| PubChem CID | 54185766 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 5-phenyl-1'-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]spiro[2,6-dihydropyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-diol |
| SMILES | Oc1[nH]c(O)c2c1CN(c1ccccc1)C21CCN([C@@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C26H29N3O2/c30-24-21-17-29(19-9-2-1-3-10-19)26(23(21)25(31)27-24)13-15-28(16-14-26)22-12-6-8-18-7-4-5-11-20(18)22/h1-5,7,9-11,22,27,30-31H,6,8,12-17H2/t22-/m1/s1 |
| InChIKey | PEZJBDGYVLXUJX-JOCHJYFZSA-N |
| XLogP | 4.81 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |