About 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine
2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine (PubChem CID 54186624) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine |
| PubChem CID | 54186624 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine |
| SMILES | Cc1nc(C)c(C=CN(C)C)s1 |
| InChI | InChI=1S/C9H14N2S/c1-7-9(5-6-11(3)4)12-8(2)10-7/h5-6H,1-4H3 |
| InChIKey | PFNSEKSAYRBLJC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine?
The IUPAC name of 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine (CID 54186624) is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine.
What is the SMILES notation for 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine?
The canonical SMILES for 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine is Cc1nc(C)c(C=CN(C)C)s1.
What is the InChIKey of 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine?
The InChIKey is PFNSEKSAYRBLJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S/c1-7-9(5-6-11(3)4)12-8(2)10-7/h5-6H,1-4H3.
What are the key properties of 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine?
2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine has a molecular weight of 182.29 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylethenamine is sourced from PubChem (CID 54186624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).