About trimethyl(octadeca-9,12-dienyl)azanium
trimethyl(octadeca-9,12-dienyl)azanium (PubChem CID 54186861) has the molecular formula C21H42N+
and a molecular weight of 308.57 g/mol. Its IUPAC name is trimethyl(octadeca-9,12-dienyl)azanium.
Molecular Properties
| Compound Name | trimethyl(octadeca-9,12-dienyl)azanium |
| PubChem CID | 54186861 |
| Molecular Formula | C21H42N+ |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.33 |
| IUPAC Name | trimethyl(octadeca-9,12-dienyl)azanium |
| SMILES | CCCCCC=CCC=CCCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C21H42N/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2,3)4/h9-10,12-13H,5-8,11,14-21H2,1-4H3/q+1 |
| InChIKey | PFRUJMXPDAEGGM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(octadeca-9,12-dienyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(octadeca-9,12-dienyl)azanium?
The IUPAC name of trimethyl(octadeca-9,12-dienyl)azanium (CID 54186861) is trimethyl(octadeca-9,12-dienyl)azanium.
What is the SMILES notation for trimethyl(octadeca-9,12-dienyl)azanium?
The canonical SMILES for trimethyl(octadeca-9,12-dienyl)azanium is CCCCCC=CCC=CCCCCCCCC[N+](C)(C)C.
What is the InChIKey of trimethyl(octadeca-9,12-dienyl)azanium?
The InChIKey is PFRUJMXPDAEGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2,3)4/h9-10,12-13H,5-8,11,14-21H2,1-4H3/q+1.
What are the key properties of trimethyl(octadeca-9,12-dienyl)azanium?
trimethyl(octadeca-9,12-dienyl)azanium has a molecular weight of 308.57 g/mol, XLogP of 6.51, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(octadeca-9,12-dienyl)azanium is sourced from PubChem (CID 54186861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).