C22H24N2 — CID 54187201
(3,4-dimethylphenyl)-(1,3,6,8-tetramethylnaphthalen-2-yl)diazene (PubChem CID 54187201) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(1,3,6,8-tetramethylnaphthalen-2-yl)diazene.
| Compound Name | (3,4-dimethylphenyl)-(1,3,6,8-tetramethylnaphthalen-2-yl)diazene |
|---|---|
| PubChem CID | 54187201 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (3,4-dimethylphenyl)-(1,3,6,8-tetramethylnaphthalen-2-yl)diazene |
| SMILES | Cc1cc(C)c2c(C)c(/N=N/c3ccc(C)c(C)c3)c(C)cc2c1 |
| InChI | InChI=1S/C22H24N2/c1-13-9-16(4)21-18(6)22(17(5)11-19(21)10-13)24-23-20-8-7-14(2)15(3)12-20/h7-12H,1-6H3/b24-23+ |
| InChIKey | PFWYIEFHVDLUND-WCWDXBQESA-N |
| XLogP | 7.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|