C9H12N2OS — CID 54187958
3-ethyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine (PubChem CID 54187958) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is 3-ethyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine.
| Compound Name | 3-ethyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
|---|---|
| PubChem CID | 54187958 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-ethyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
| SMILES | CCC1COc2ccsc2C(N)=N1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-6-5-12-7-3-4-13-8(7)9(10)11-6/h3-4,6H,2,5H2,1H3,(H2,10,11) |
| InChIKey | PGLJDFZXYMIATH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |