C37H39N8O2S+ — CID 54188160
(4-azido-2-nitrophenyl)-ethyl-[3-(ethylamino)propyl]-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]-1-phenylquinolin-2-yl]azanium (PubChem CID 54188160) has the molecular formula C37H39N8O2S+ and a molecular weight of 659.84 g/mol. Its IUPAC name is (4-azido-2-nitrophenyl)-ethyl-[3-(ethylamino)propyl]-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]-1-phenylquinolin-2-yl]azanium.
| Compound Name | (4-azido-2-nitrophenyl)-ethyl-[3-(ethylamino)propyl]-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]-1-phenylquinolin-2-yl]azanium |
|---|---|
| PubChem CID | 54188160 |
| Molecular Formula | C37H39N8O2S+ |
| Molecular Weight | 659.84 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | (4-azido-2-nitrophenyl)-ethyl-[3-(ethylamino)propyl]-[4-[(3-methyl-2H-1,3-benzothiazol-2-yl)methylidene]-1-phenylquinolin-2-yl]azanium |
| SMILES | CCNCCC[N+](CC)(C1=CC(=CC2Sc3ccccc3N2C)c2ccccc2N1c1ccccc1)c1ccc(N=[N+]=[N-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C37H39N8O2S/c1-4-39-22-13-23-45(5-2,34-21-20-28(40-41-38)26-33(34)44(46)47)36-24-27(25-37-42(3)32-18-11-12-19-35(32)48-37)30-16-9-10-17-31(30)43(36)29-14-7-6-8-15-29/h6-12,14-21,24-26,37,39H,4-5,13,22-23H2,1-3H3/q+1 |
| InChIKey | SZOOQQNBEWEBDI-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.84 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|