About ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate
ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate (PubChem CID 541884) has the molecular formula C11H19F3N2O3
and a molecular weight of 284.28 g/mol. Its IUPAC name is ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate.
Molecular Properties
| Compound Name | ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate |
| PubChem CID | 541884 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(NC(C)=O)(NC(C)CC)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O3/c1-5-7(3)15-10(11(12,13)14,16-8(4)17)9(18)19-6-2/h7,15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | CHNNIWAHOUNMQU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate?
The IUPAC name of ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate (CID 541884) is ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate.
What is the SMILES notation for ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate?
The canonical SMILES for ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate is CCOC(=O)C(NC(C)=O)(NC(C)CC)C(F)(F)F.
What is the InChIKey of ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate?
The InChIKey is CHNNIWAHOUNMQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2O3/c1-5-7(3)15-10(11(12,13)14,16-8(4)17)9(18)19-6-2/h7,15H,5-6H2,1-4H3,(H,16,17).
What are the key properties of ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate?
ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate has a molecular weight of 284.28 g/mol, XLogP of 1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetamido-2-(butan-2-ylamino)-3,3,3-trifluoropropanoate is sourced from PubChem (CID 541884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).