About 3-hexyl-2-N,3-dimethylnonane-1,2-diamine
3-hexyl-2-N,3-dimethylnonane-1,2-diamine (PubChem CID 54188638) has the molecular formula C17H38N2
and a molecular weight of 270.50 g/mol. Its IUPAC name is 3-hexyl-2-N,3-dimethylnonane-1,2-diamine.
Molecular Properties
| Compound Name | 3-hexyl-2-N,3-dimethylnonane-1,2-diamine |
| PubChem CID | 54188638 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 3-hexyl-2-N,3-dimethylnonane-1,2-diamine |
| SMILES | CCCCCCC(C)(CCCCCC)C(CN)NC |
| InChI | InChI=1S/C17H38N2/c1-5-7-9-11-13-17(3,16(15-18)19-4)14-12-10-8-6-2/h16,19H,5-15,18H2,1-4H3 |
| InChIKey | PGXQIERCBABMKR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-2-N,3-dimethylnonane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-2-N,3-dimethylnonane-1,2-diamine?
The IUPAC name of 3-hexyl-2-N,3-dimethylnonane-1,2-diamine (CID 54188638) is 3-hexyl-2-N,3-dimethylnonane-1,2-diamine.
What is the SMILES notation for 3-hexyl-2-N,3-dimethylnonane-1,2-diamine?
The canonical SMILES for 3-hexyl-2-N,3-dimethylnonane-1,2-diamine is CCCCCCC(C)(CCCCCC)C(CN)NC.
What is the InChIKey of 3-hexyl-2-N,3-dimethylnonane-1,2-diamine?
The InChIKey is PGXQIERCBABMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38N2/c1-5-7-9-11-13-17(3,16(15-18)19-4)14-12-10-8-6-2/h16,19H,5-15,18H2,1-4H3.
What are the key properties of 3-hexyl-2-N,3-dimethylnonane-1,2-diamine?
3-hexyl-2-N,3-dimethylnonane-1,2-diamine has a molecular weight of 270.50 g/mol, XLogP of 4.48, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-2-N,3-dimethylnonane-1,2-diamine is sourced from PubChem (CID 54188638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).