C19H14N2O8S — CID 54188931
3-acetyloxy-4-[(3-nitrobenzoyl)amino]naphthalene-1-sulfonic acid (PubChem CID 54188931) has the molecular formula C19H14N2O8S and a molecular weight of 430.39 g/mol. Its IUPAC name is 3-acetyloxy-4-[(3-nitrobenzoyl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 3-acetyloxy-4-[(3-nitrobenzoyl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 54188931 |
| Molecular Formula | C19H14N2O8S |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 3-acetyloxy-4-[(3-nitrobenzoyl)amino]naphthalene-1-sulfonic acid |
| SMILES | CC(=O)Oc1cc(S(=O)(=O)O)c2ccccc2c1NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N2O8S/c1-11(22)29-16-10-17(30(26,27)28)14-7-2-3-8-15(14)18(16)20-19(23)12-5-4-6-13(9-12)21(24)25/h2-10H,1H3,(H,20,23)(H,26,27,28) |
| InChIKey | PHCWCQDDEHXZQO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 152.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|