C13H14O6 — CID 54189240
3-(3,4-diacetyl-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid (PubChem CID 54189240) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-(3,4-diacetyl-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid.
| Compound Name | 3-(3,4-diacetyl-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54189240 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-(3,4-diacetyl-3,4-dihydroxycyclohexa-1,5-dien-1-yl)prop-2-enoic acid |
| SMILES | CC(=O)C1(O)C=CC(C=CC(=O)O)=CC1(O)C(C)=O |
| InChI | InChI=1S/C13H14O6/c1-8(14)12(18)6-5-10(3-4-11(16)17)7-13(12,19)9(2)15/h3-7,18-19H,1-2H3,(H,16,17) |
| InChIKey | PHIGPDLWBYXTJM-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|