About 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid
2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid (PubChem CID 54189259) has the molecular formula C8H12N2O6
and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid |
| PubChem CID | 54189259 |
| Molecular Formula | C8H12N2O6 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CC(=O)N(CC(O)O)CC1=O |
| InChI | InChI=1S/C8H12N2O6/c11-5-1-9(3-7(13)14)6(12)2-10(5)4-8(15)16/h7,13-14H,1-4H2,(H,15,16) |
| InChIKey | PHILNYKPQVIYFK-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid?
The IUPAC name of 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid (CID 54189259) is 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid?
The canonical SMILES for 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid is O=C(O)CN1CC(=O)N(CC(O)O)CC1=O.
What is the InChIKey of 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid?
The InChIKey is PHILNYKPQVIYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O6/c11-5-1-9(3-7(13)14)6(12)2-10(5)4-8(15)16/h7,13-14H,1-4H2,(H,15,16).
What are the key properties of 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid?
2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid has a molecular weight of 232.19 g/mol, XLogP of -2.95, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-dihydroxyethyl)-2,5-dioxopiperazin-1-yl]acetic acid is sourced from PubChem (CID 54189259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).