C23H26N2O3 — CID 54189380
7-heptan-4-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one (PubChem CID 54189380) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 7-heptan-4-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one.
| Compound Name | 7-heptan-4-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one |
|---|---|
| PubChem CID | 54189380 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 7-heptan-4-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one |
| SMILES | CCCC(CCC)N1N=C(c2ccccc2)c2cc3c(cc2CC1=O)OCO3 |
| InChI | InChI=1S/C23H26N2O3/c1-3-8-18(9-4-2)25-22(26)13-17-12-20-21(28-15-27-20)14-19(17)23(24-25)16-10-6-5-7-11-16/h5-7,10-12,14,18H,3-4,8-9,13,15H2,1-2H3 |
| InChIKey | PHKMGIAFOSQBNR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |