About 5-amino-1,4-benzodiazepin-2-one
5-amino-1,4-benzodiazepin-2-one (PubChem CID 54189383) has the molecular formula C9H7N3O
and a molecular weight of 173.17 g/mol. Its IUPAC name is 5-amino-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 5-amino-1,4-benzodiazepin-2-one |
| PubChem CID | 54189383 |
| Molecular Formula | C9H7N3O |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-amino-1,4-benzodiazepin-2-one |
| SMILES | Nc1ncc(=O)nc2ccccc12 |
| InChI | InChI=1S/C9H7N3O/c10-9-6-3-1-2-4-7(6)12-8(13)5-11-9/h1-5H,10H2 |
| InChIKey | PHKNGKXEHODFMA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,4-benzodiazepin-2-one?
The IUPAC name of 5-amino-1,4-benzodiazepin-2-one (CID 54189383) is 5-amino-1,4-benzodiazepin-2-one.
What is the SMILES notation for 5-amino-1,4-benzodiazepin-2-one?
The canonical SMILES for 5-amino-1,4-benzodiazepin-2-one is Nc1ncc(=O)nc2ccccc12.
What is the InChIKey of 5-amino-1,4-benzodiazepin-2-one?
The InChIKey is PHKNGKXEHODFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O/c10-9-6-3-1-2-4-7(6)12-8(13)5-11-9/h1-5H,10H2.
What are the key properties of 5-amino-1,4-benzodiazepin-2-one?
5-amino-1,4-benzodiazepin-2-one has a molecular weight of 173.17 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,4-benzodiazepin-2-one is sourced from PubChem (CID 54189383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).