C21H22O2 — CID 54189481
2,2,3,3,10-pentamethylphenanthro[9,10-b][1,4]dioxine (PubChem CID 54189481) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2,2,3,3,10-pentamethylphenanthro[9,10-b][1,4]dioxine.
| Compound Name | 2,2,3,3,10-pentamethylphenanthro[9,10-b][1,4]dioxine |
|---|---|
| PubChem CID | 54189481 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2,2,3,3,10-pentamethylphenanthro[9,10-b][1,4]dioxine |
| SMILES | Cc1ccc2c3c(c4ccccc4c2c1)OC(C)(C)C(C)(C)O3 |
| InChI | InChI=1S/C21H22O2/c1-13-10-11-16-17(12-13)14-8-6-7-9-15(14)18-19(16)23-21(4,5)20(2,3)22-18/h6-12H,1-5H3 |
| InChIKey | PHMGQWHAAYZZFN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|