C30H41FO2 — CID 54189667
(3S,5R,10S,13R,17S)-17-[(1R)-1-[(3-fluorophenyl)methoxy]ethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 54189667) has the molecular formula C30H41FO2 and a molecular weight of 452.65 g/mol. Its IUPAC name is (3S,5R,10S,13R,17S)-17-[(1R)-1-[(3-fluorophenyl)methoxy]ethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,10S,13R,17S)-17-[(1R)-1-[(3-fluorophenyl)methoxy]ethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54189667 |
| Molecular Formula | C30H41FO2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (3S,5R,10S,13R,17S)-17-[(1R)-1-[(3-fluorophenyl)methoxy]ethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H](OCc1cccc(F)c1)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C30H41FO2/c1-19(33-18-20-7-6-8-21(31)17-20)23-10-11-24-22-9-12-26-28(2,3)27(32)14-16-30(26,5)25(22)13-15-29(23,24)4/h6-8,11,17,19,23,26-27,32H,9-10,12-16,18H2,1-5H3/t19-,23-,26+,27+,29-,30-/m1/s1 |
| InChIKey | PHPURAKQYDPPSQ-MITRRIQNSA-N |
| XLogP | 7.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |