C21H31NO — CID 54189898
1-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,8,12-tetraene-1-carbonitrile (PubChem CID 54189898) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,8,12-tetraene-1-carbonitrile.
| Compound Name | 1-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,8,12-tetraene-1-carbonitrile |
|---|---|
| PubChem CID | 54189898 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 1-hydroxy-5,9,13-trimethyl-2-propan-2-ylcyclotetradeca-2,4,8,12-tetraene-1-carbonitrile |
| SMILES | CC1=CC=C(C(C)C)C(O)(C#N)CC(C)=CCCC(C)=CCC1 |
| InChI | InChI=1S/C21H31NO/c1-16(2)20-13-12-18(4)10-6-8-17(3)9-7-11-19(5)14-21(20,23)15-22/h8,11-13,16,23H,6-7,9-10,14H2,1-5H3 |
| InChIKey | PHTSNPQUHHHRGT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|