C22H29N4O+ — CID 54190251
[9-(3-aminopropyl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaene-8-carbonyl]-trimethylazanium (PubChem CID 54190251) has the molecular formula C22H29N4O+ and a molecular weight of 365.50 g/mol. Its IUPAC name is [9-(3-aminopropyl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaene-8-carbonyl]-trimethylazanium.
| Compound Name | [9-(3-aminopropyl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaene-8-carbonyl]-trimethylazanium |
|---|---|
| PubChem CID | 54190251 |
| Molecular Formula | C22H29N4O+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | [9-(3-aminopropyl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaene-8-carbonyl]-trimethylazanium |
| SMILES | C[N+](C)(C)C(=O)N1c2ccccc2N2CCc3cccc(c32)C1CCCN |
| InChI | InChI=1S/C22H29N4O/c1-26(2,3)22(27)25-18(12-7-14-23)17-9-6-8-16-13-15-24(21(16)17)19-10-4-5-11-20(19)25/h4-6,8-11,18H,7,12-15,23H2,1-3H3/q+1 |
| InChIKey | CCDLKWWAWUBYNW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|