C14H30NP — CID 54190485
5-[dimethyl(methylidene)-λ5-phosphanyl]-N,N,3,3,4,4-hexamethylpent-1-en-2-amine (PubChem CID 54190485) has the molecular formula C14H30NP and a molecular weight of 243.37 g/mol. Its IUPAC name is 5-[dimethyl(methylidene)-λ5-phosphanyl]-N,N,3,3,4,4-hexamethylpent-1-en-2-amine.
| Compound Name | 5-[dimethyl(methylidene)-λ5-phosphanyl]-N,N,3,3,4,4-hexamethylpent-1-en-2-amine |
|---|---|
| PubChem CID | 54190485 |
| Molecular Formula | C14H30NP |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | 5-[dimethyl(methylidene)-λ5-phosphanyl]-N,N,3,3,4,4-hexamethylpent-1-en-2-amine |
| SMILES | C=C(N(C)C)C(C)(C)C(C)(C)CP(=C)(C)C |
| InChI | InChI=1S/C14H30NP/c1-12(15(6)7)14(4,5)13(2,3)11-16(8,9)10/h1,8,11H2,2-7,9-10H3 |
| InChIKey | PIEAJWMIJAXYNG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|