About [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate (PubChem CID 54191454) has the molecular formula C18H18F6O2S
and a molecular weight of 412.40 g/mol. Its IUPAC name is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate |
| PubChem CID | 54191454 |
| Molecular Formula | C18H18F6O2S |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H18F6O2S/c1-2-3-4-5-13-6-8-14(9-7-13)18(25)26-15-10-11-17(16(19)12-15)27(20,21,22,23)24/h6-12H,2-5H2,1H3 |
| InChIKey | PIURKXSLPKPHAE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate?
The IUPAC name of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate (CID 54191454) is [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate.
What is the SMILES notation for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate?
The canonical SMILES for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate is CCCCCc1ccc(C(=O)Oc2ccc(S(F)(F)(F)(F)F)c(F)c2)cc1.
What is the InChIKey of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate?
The InChIKey is PIURKXSLPKPHAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F6O2S/c1-2-3-4-5-13-6-8-14(9-7-13)18(25)26-15-10-11-17(16(19)12-15)27(20,21,22,23)24/h6-12H,2-5H2,1H3.
What are the key properties of [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate?
[3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate has a molecular weight of 412.40 g/mol, XLogP of 7.43, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(pentafluoro-λ6-sulfanyl)phenyl] 4-pentylbenzoate is sourced from PubChem (CID 54191454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).