About methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate
methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 54191704) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate.
Analyze methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate?
The IUPAC name of methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate (CID 54191704) is methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate.
What is the SMILES notation for methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate?
The canonical SMILES for methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate is CCC1=C(C(=O)OC)CCCO1.
What is the InChIKey of methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate?
The InChIKey is PIYPVRXVYBFIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-3-8-7(9(10)11-2)5-4-6-12-8/h3-6H2,1-2H3.
What are the key properties of methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate?
methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-ethyl-3,4-dihydro-2H-pyran-5-carboxylate is sourced from PubChem (CID 54191704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).