About 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine
7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine (PubChem CID 54191745) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine |
| PubChem CID | 54191745 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine |
| SMILES | Cc1c(C)n(C)c2c(Cl)nncc12 |
| InChI | InChI=1S/C9H10ClN3/c1-5-6(2)13(3)8-7(5)4-11-12-9(8)10/h4H,1-3H3 |
| InChIKey | PIZHEYSHENJOAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine?
The IUPAC name of 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine (CID 54191745) is 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine.
What is the SMILES notation for 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine?
The canonical SMILES for 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine is Cc1c(C)n(C)c2c(Cl)nncc12.
What is the InChIKey of 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine?
The InChIKey is PIZHEYSHENJOAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3/c1-5-6(2)13(3)8-7(5)4-11-12-9(8)10/h4H,1-3H3.
What are the key properties of 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine?
7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine has a molecular weight of 195.65 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,2,3-trimethylpyrrolo[2,3-d]pyridazine is sourced from PubChem (CID 54191745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).