C34H67N5O4 — CID 541918
N'-heptyl-N-[6-[6-[[3-[heptyl(methyl)amino]-3-oxopropanoyl]amino]hexylamino]hexyl]-N'-methylpropanediamide (PubChem CID 541918) has the molecular formula C34H67N5O4 and a molecular weight of 609.94 g/mol. Its IUPAC name is N'-heptyl-N-[6-[6-[[3-[heptyl(methyl)amino]-3-oxopropanoyl]amino]hexylamino]hexyl]-N'-methylpropanediamide.
| Compound Name | N'-heptyl-N-[6-[6-[[3-[heptyl(methyl)amino]-3-oxopropanoyl]amino]hexylamino]hexyl]-N'-methylpropanediamide |
|---|---|
| PubChem CID | 541918 |
| Molecular Formula | C34H67N5O4 |
| Molecular Weight | 609.94 g/mol |
| Exact Mass | 609.52 |
| IUPAC Name | N'-heptyl-N-[6-[6-[[3-[heptyl(methyl)amino]-3-oxopropanoyl]amino]hexylamino]hexyl]-N'-methylpropanediamide |
| SMILES | CCCCCCCN(C)C(=O)CC(=O)NCCCCCCNCCCCCCNC(=O)CC(=O)N(C)CCCCCCC |
| InChI | InChI=1S/C34H67N5O4/c1-5-7-9-15-21-27-38(3)33(42)29-31(40)36-25-19-13-11-17-23-35-24-18-12-14-20-26-37-32(41)30-34(43)39(4)28-22-16-10-8-6-2/h35H,5-30H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | HUIXPILUDMGPQK-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|