C22H21N3OS — CID 54191891
[3-[(4-methylphenyl)methyl]imidazol-4-yl]-[6-(4-methylthiophen-3-yl)-3-pyridinyl]methanol (PubChem CID 54191891) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is [3-[(4-methylphenyl)methyl]imidazol-4-yl]-[6-(4-methylthiophen-3-yl)-3-pyridinyl]methanol.
| Compound Name | [3-[(4-methylphenyl)methyl]imidazol-4-yl]-[6-(4-methylthiophen-3-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 54191891 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [3-[(4-methylphenyl)methyl]imidazol-4-yl]-[6-(4-methylthiophen-3-yl)-3-pyridinyl]methanol |
| SMILES | Cc1ccc(Cn2cncc2C(O)c2ccc(-c3cscc3C)nc2)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-15-3-5-17(6-4-15)11-25-14-23-10-21(25)22(26)18-7-8-20(24-9-18)19-13-27-12-16(19)2/h3-10,12-14,22,26H,11H2,1-2H3 |
| InChIKey | PJBRSIQVOGIHGY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |