About 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one
8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one (PubChem CID 54192117) has the molecular formula C13H8Cl2FN3O
and a molecular weight of 312.13 g/mol. Its IUPAC name is 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one |
| PubChem CID | 54192117 |
| Molecular Formula | C13H8Cl2FN3O |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one |
| SMILES | Cc1cc(-n2c(=O)cc(F)n3ccnc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl2FN3O/c1-7-4-10(9(15)5-8(7)14)19-12(20)6-11(16)18-3-2-17-13(18)19/h2-6H,1H3 |
| InChIKey | KYDZIRWZOJTDKH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one?
The IUPAC name of 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one (CID 54192117) is 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one.
What is the SMILES notation for 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one?
The canonical SMILES for 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one is Cc1cc(-n2c(=O)cc(F)n3ccnc23)c(Cl)cc1Cl.
What is the InChIKey of 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one?
The InChIKey is KYDZIRWZOJTDKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2FN3O/c1-7-4-10(9(15)5-8(7)14)19-12(20)6-11(16)18-3-2-17-13(18)19/h2-6H,1H3.
What are the key properties of 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one?
8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one has a molecular weight of 312.13 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dichloro-5-methylphenyl)-5-fluoroimidazo[1,2-a]pyrimidin-7-one is sourced from PubChem (CID 54192117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).