About methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate
methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate (PubChem CID 54192904) has the molecular formula C15H28N4O2S
and a molecular weight of 328.48 g/mol. Its IUPAC name is methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate |
| PubChem CID | 54192904 |
| Molecular Formula | C15H28N4O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate |
| SMILES | CSC(=NC(=O)NC1CC(C)C(C)C1)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H28N4O2S/c1-9-7-11(8-10(9)2)16-12(20)17-14(22-6)18-13(21)19-15(3,4)5/h9-11H,7-8H2,1-6H3,(H3,16,17,18,19,20,21) |
| InChIKey | PJTCVLITSMFWIS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate?
The IUPAC name of methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate (CID 54192904) is methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate.
What is the SMILES notation for methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate?
The canonical SMILES for methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate is CSC(=NC(=O)NC1CC(C)C(C)C1)NC(=O)NC(C)(C)C.
What is the InChIKey of methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate?
The InChIKey is PJTCVLITSMFWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O2S/c1-9-7-11(8-10(9)2)16-12(20)17-14(22-6)18-13(21)19-15(3,4)5/h9-11H,7-8H2,1-6H3,(H3,16,17,18,19,20,21).
What are the key properties of methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate?
methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate has a molecular weight of 328.48 g/mol, XLogP of 2.95, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(tert-butylcarbamoyl)-N'-[(3,4-dimethylcyclopentyl)carbamoyl]carbamimidothioate is sourced from PubChem (CID 54192904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).