About 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione
8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 541931) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione.
Molecular Properties
| Compound Name | 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| PubChem CID | 541931 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | CC1NC(=O)C2(CCCC2)NC1=O |
| InChI | InChI=1S/C9H14N2O2/c1-6-7(12)11-9(8(13)10-6)4-2-3-5-9/h6H,2-5H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | LTRSPDHUDXWHRY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The IUPAC name of 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione (CID 541931) is 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione.
What is the SMILES notation for 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The canonical SMILES for 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione is CC1NC(=O)C2(CCCC2)NC1=O.
What is the InChIKey of 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
The InChIKey is LTRSPDHUDXWHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6-7(12)11-9(8(13)10-6)4-2-3-5-9/h6H,2-5H2,1H3,(H,10,13)(H,11,12).
What are the key properties of 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione?
8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione has a molecular weight of 182.22 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6,9-diazaspiro[4.5]decane-7,10-dione is sourced from PubChem (CID 541931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).