C9H8O7 — CID 54193356
1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4,6-dicarboxylic acid (PubChem CID 54193356) has the molecular formula C9H8O7 and a molecular weight of 228.16 g/mol. Its IUPAC name is 1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4,6-dicarboxylic acid.
| Compound Name | 1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4,6-dicarboxylic acid |
|---|---|
| PubChem CID | 54193356 |
| Molecular Formula | C9H8O7 |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]furan-4,6-dicarboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)O)C2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C9H8O7/c10-6(11)2-1-3(7(12)13)5-4(2)8(14)16-9(5)15/h2-5H,1H2,(H,10,11)(H,12,13) |
| InChIKey | PKAZTQAYYAYDTA-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|