C46H43BrN2O10 — CID 54193596
1,4-dimethylpyrrole-2-carboxylic acid;phenacyl 4-(bromomethyl)benzoate;(4-phenacyloxycarbonylphenyl)methyl 1,4-dimethylpyrrole-2-carboxylate (PubChem CID 54193596) has the molecular formula C46H43BrN2O10 and a molecular weight of 863.76 g/mol. Its IUPAC name is 1,4-dimethylpyrrole-2-carboxylic acid;phenacyl 4-(bromomethyl)benzoate;(4-phenacyloxycarbonylphenyl)methyl 1,4-dimethylpyrrole-2-carboxylate.
| Compound Name | 1,4-dimethylpyrrole-2-carboxylic acid;phenacyl 4-(bromomethyl)benzoate;(4-phenacyloxycarbonylphenyl)methyl 1,4-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 54193596 |
| Molecular Formula | C46H43BrN2O10 |
| Molecular Weight | 863.76 g/mol |
| Exact Mass | 862.21 |
| IUPAC Name | 1,4-dimethylpyrrole-2-carboxylic acid;phenacyl 4-(bromomethyl)benzoate;(4-phenacyloxycarbonylphenyl)methyl 1,4-dimethylpyrrole-2-carboxylate |
| SMILES | Cc1cc(C(=O)O)n(C)c1.Cc1cc(C(=O)OCc2ccc(C(=O)OCC(=O)c3ccccc3)cc2)n(C)c1.O=C(COC(=O)c1ccc(CBr)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO5.C16H13BrO3.C7H9NO2/c1-16-12-20(24(2)13-16)23(27)28-14-17-8-10-19(11-9-17)22(26)29-15-21(25)18-6-4-3-5-7-18;17-10-12-6-8-14(9-7-12)16(19)20-11-15(18)13-4-2-1-3-5-13;1-5-3-6(7(9)10)8(2)4-5/h3-13H,14-15H2,1-2H3;1-9H,10-11H2;3-4H,1-2H3,(H,9,10) |
| InChIKey | PKFBSUHIQKSJRJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 160.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.76 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|