About 2-butyl-6-methoxy-3,4,5-trimethyloxane
2-butyl-6-methoxy-3,4,5-trimethyloxane (PubChem CID 54194283) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-butyl-6-methoxy-3,4,5-trimethyloxane.
Molecular Properties
| Compound Name | 2-butyl-6-methoxy-3,4,5-trimethyloxane |
| PubChem CID | 54194283 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-butyl-6-methoxy-3,4,5-trimethyloxane |
| SMILES | CCCCC1OC(OC)C(C)C(C)C1C |
| InChI | InChI=1S/C13H26O2/c1-6-7-8-12-10(3)9(2)11(4)13(14-5)15-12/h9-13H,6-8H2,1-5H3 |
| InChIKey | PKRSOGFSTOVPGA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-6-methoxy-3,4,5-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-methoxy-3,4,5-trimethyloxane?
The IUPAC name of 2-butyl-6-methoxy-3,4,5-trimethyloxane (CID 54194283) is 2-butyl-6-methoxy-3,4,5-trimethyloxane.
What is the SMILES notation for 2-butyl-6-methoxy-3,4,5-trimethyloxane?
The canonical SMILES for 2-butyl-6-methoxy-3,4,5-trimethyloxane is CCCCC1OC(OC)C(C)C(C)C1C.
What is the InChIKey of 2-butyl-6-methoxy-3,4,5-trimethyloxane?
The InChIKey is PKRSOGFSTOVPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-6-7-8-12-10(3)9(2)11(4)13(14-5)15-12/h9-13H,6-8H2,1-5H3.
What are the key properties of 2-butyl-6-methoxy-3,4,5-trimethyloxane?
2-butyl-6-methoxy-3,4,5-trimethyloxane has a molecular weight of 214.35 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-methoxy-3,4,5-trimethyloxane is sourced from PubChem (CID 54194283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).