About 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine
1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine (PubChem CID 54194555) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 54194555 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CCC(ON=C1CCc2c1ccc1ccccc21)N(C)C |
| InChI | InChI=1S/C18H22N2O/c1-4-18(20(2)3)21-19-17-12-11-15-14-8-6-5-7-13(14)9-10-16(15)17/h5-10,18H,4,11-12H2,1-3H3 |
| InChIKey | PKWOPSIWSSYLRV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine (CID 54194555) is 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine is CCC(ON=C1CCc2c1ccc1ccccc21)N(C)C.
What is the InChIKey of 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine?
The InChIKey is PKWOPSIWSSYLRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c1-4-18(20(2)3)21-19-17-12-11-15-14-8-6-5-7-13(14)9-10-16(15)17/h5-10,18H,4,11-12H2,1-3H3.
What are the key properties of 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine?
1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine has a molecular weight of 282.39 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dihydrocyclopenta[a]naphthalen-3-ylideneamino)oxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 54194555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).