About (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane
(2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane (PubChem CID 54194992) has the molecular formula C20H24O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane.
Molecular Properties
| Compound Name | (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane |
| PubChem CID | 54194992 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane |
| SMILES | CCCc1ccc([C@H]2CO[C@H](c3ccc(C)cc3)CO2)cc1 |
| InChI | InChI=1S/C20H24O2/c1-3-4-16-7-11-18(12-8-16)20-14-21-19(13-22-20)17-9-5-15(2)6-10-17/h5-12,19-20H,3-4,13-14H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | PLDWDCMKXPUXFI-VQTJNVASSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane?
The IUPAC name of (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane (CID 54194992) is (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane.
What is the SMILES notation for (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane?
The canonical SMILES for (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane is CCCc1ccc([C@H]2CO[C@H](c3ccc(C)cc3)CO2)cc1.
What is the InChIKey of (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane?
The InChIKey is PLDWDCMKXPUXFI-VQTJNVASSA-N. The full InChI is InChI=1S/C20H24O2/c1-3-4-16-7-11-18(12-8-16)20-14-21-19(13-22-20)17-9-5-15(2)6-10-17/h5-12,19-20H,3-4,13-14H2,1-2H3/t19-,20+/m0/s1.
What are the key properties of (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane?
(2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane has a molecular weight of 296.41 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2-(4-methylphenyl)-5-(4-propylphenyl)-1,4-dioxane is sourced from PubChem (CID 54194992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).