C13H17N — CID 54195015
2,4,5,6,7-pentamethyl-3H-indole (PubChem CID 54195015) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2,4,5,6,7-pentamethyl-3H-indole.
| Compound Name | 2,4,5,6,7-pentamethyl-3H-indole |
|---|---|
| PubChem CID | 54195015 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2,4,5,6,7-pentamethyl-3H-indole |
| SMILES | CC1=Nc2c(C)c(C)c(C)c(C)c2C1 |
| InChI | InChI=1S/C13H17N/c1-7-6-12-10(4)8(2)9(3)11(5)13(12)14-7/h6H2,1-5H3 |
| InChIKey | PLEIKVRDHWKZHF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |