C18H35N — CID 54195042
N,N-di(butan-2-yl)-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 54195042) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | N,N-di(butan-2-yl)-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 54195042 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | N,N-di(butan-2-yl)-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CCC(C)N(CC=C(C)CCC=C(C)C)C(C)CC |
| InChI | InChI=1S/C18H35N/c1-8-17(6)19(18(7)9-2)14-13-16(5)12-10-11-15(3)4/h11,13,17-18H,8-10,12,14H2,1-7H3 |
| InChIKey | PLEVJESFFHQKMF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|