About 3,4-dimethyl-5H-1,2,4-oxadiazole
3,4-dimethyl-5H-1,2,4-oxadiazole (PubChem CID 54195082) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 3,4-dimethyl-5H-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3,4-dimethyl-5H-1,2,4-oxadiazole |
| PubChem CID | 54195082 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 3,4-dimethyl-5H-1,2,4-oxadiazole |
| SMILES | CC1=NOCN1C |
| InChI | InChI=1S/C4H8N2O/c1-4-5-7-3-6(4)2/h3H2,1-2H3 |
| InChIKey | PLFPMZKTGFAYGE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethyl-5H-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5H-1,2,4-oxadiazole?
The IUPAC name of 3,4-dimethyl-5H-1,2,4-oxadiazole (CID 54195082) is 3,4-dimethyl-5H-1,2,4-oxadiazole.
What is the SMILES notation for 3,4-dimethyl-5H-1,2,4-oxadiazole?
The canonical SMILES for 3,4-dimethyl-5H-1,2,4-oxadiazole is CC1=NOCN1C.
What is the InChIKey of 3,4-dimethyl-5H-1,2,4-oxadiazole?
The InChIKey is PLFPMZKTGFAYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c1-4-5-7-3-6(4)2/h3H2,1-2H3.
What are the key properties of 3,4-dimethyl-5H-1,2,4-oxadiazole?
3,4-dimethyl-5H-1,2,4-oxadiazole has a molecular weight of 100.12 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5H-1,2,4-oxadiazole is sourced from PubChem (CID 54195082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).