About 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid
3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid (PubChem CID 54195242) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid |
| PubChem CID | 54195242 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1=CC=CC1)C(=O)O |
| InChI | InChI=1S/C9H10O2/c1-7(9(10)11)6-8-4-2-3-5-8/h2-4,6H,5H2,1H3,(H,10,11) |
| InChIKey | PLINQPPOZATIKP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid?
The IUPAC name of 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid (CID 54195242) is 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid.
What is the SMILES notation for 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid?
The canonical SMILES for 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid is CC(=CC1=CC=CC1)C(=O)O.
What is the InChIKey of 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid?
The InChIKey is PLINQPPOZATIKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-7(9(10)11)6-8-4-2-3-5-8/h2-4,6H,5H2,1H3,(H,10,11).
What are the key properties of 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid?
3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid has a molecular weight of 150.18 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-1,3-dien-1-yl-2-methylprop-2-enoic acid is sourced from PubChem (CID 54195242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).