C34H49N5O7S — CID 54195433
methyl 6-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-[2-[[(2R)-2-[[(2S)-2-(ethylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoate (PubChem CID 54195433) has the molecular formula C34H49N5O7S and a molecular weight of 671.86 g/mol. Its IUPAC name is methyl 6-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-[2-[[(2R)-2-[[(2S)-2-(ethylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-[2-[[(2R)-2-[[(2S)-2-(ethylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 54195433 |
| Molecular Formula | C34H49N5O7S |
| Molecular Weight | 671.86 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | methyl 6-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-[2-[[(2R)-2-[[(2S)-2-(ethylamino)-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoate |
| SMILES | CCN[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CCSC)C(=O)NCC(=O)N(CCCCCC(=O)OC)[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C34H49N5O7S/c1-4-36-28(21-25-14-16-26(40)17-15-25)34(45)38-27(18-20-47-3)33(44)37-23-30(41)39(19-10-6-9-13-31(42)46-2)29(32(35)43)22-24-11-7-5-8-12-24/h5,7-8,11-12,14-17,27-29,36,40H,4,6,9-10,13,18-23H2,1-3H3,(H2,35,43)(H,37,44)(H,38,45)/t27-,28+,29+/m1/s1 |
| InChIKey | PLLYEFGYRCXYCY-ULNSLHSMSA-N |
| XLogP | 1.93 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.86 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|