About azepino[2,1-b]quinazoline
azepino[2,1-b]quinazoline (PubChem CID 54195578) has the molecular formula C13H10N2
and a molecular weight of 194.24 g/mol. Its IUPAC name is azepino[2,1-b]quinazoline.
Molecular Properties
| Compound Name | azepino[2,1-b]quinazoline |
| PubChem CID | 54195578 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | azepino[2,1-b]quinazoline |
| SMILES | C1=CC=C2N=c3ccccc3=CN2C=C1 |
| InChI | InChI=1S/C13H10N2/c1-2-8-13-14-12-7-4-3-6-11(12)10-15(13)9-5-1/h1-10H |
| InChIKey | PLOKAGZSTOYSIK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azepino[2,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepino[2,1-b]quinazoline?
The IUPAC name of azepino[2,1-b]quinazoline (CID 54195578) is azepino[2,1-b]quinazoline.
What is the SMILES notation for azepino[2,1-b]quinazoline?
The canonical SMILES for azepino[2,1-b]quinazoline is C1=CC=C2N=c3ccccc3=CN2C=C1.
What is the InChIKey of azepino[2,1-b]quinazoline?
The InChIKey is PLOKAGZSTOYSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2/c1-2-8-13-14-12-7-4-3-6-11(12)10-15(13)9-5-1/h1-10H.
What are the key properties of azepino[2,1-b]quinazoline?
azepino[2,1-b]quinazoline has a molecular weight of 194.24 g/mol, XLogP of 1.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepino[2,1-b]quinazoline is sourced from PubChem (CID 54195578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).