C23H31FN2O4S — CID 54195651
2-[4-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54195651) has the molecular formula C23H31FN2O4S and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[4-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[4-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54195651 |
| Molecular Formula | C23H31FN2O4S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[4-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1CCN(CCCCn2c(O)c3c(c2O)CCCC3)CC1 |
| InChI | InChI=1S/C23H31FN2O4S/c24-17-7-9-18(10-8-17)31(29,30)19-11-15-25(16-12-19)13-3-4-14-26-22(27)20-5-1-2-6-21(20)23(26)28/h7-10,19,27-28H,1-6,11-16H2 |
| InChIKey | PLPLWOVFQNYUOE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|