About 4,5-dibutyl-2H-triazole
4,5-dibutyl-2H-triazole (PubChem CID 54195681) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 4,5-dibutyl-2H-triazole.
Molecular Properties
| Compound Name | 4,5-dibutyl-2H-triazole |
| PubChem CID | 54195681 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 4,5-dibutyl-2H-triazole |
| SMILES | CCCCc1n[nH]nc1CCCC |
| InChI | InChI=1S/C10H19N3/c1-3-5-7-9-10(8-6-4-2)12-13-11-9/h3-8H2,1-2H3,(H,11,12,13) |
| InChIKey | PLPYSSVNSLXRDC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dibutyl-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibutyl-2H-triazole?
The IUPAC name of 4,5-dibutyl-2H-triazole (CID 54195681) is 4,5-dibutyl-2H-triazole.
What is the SMILES notation for 4,5-dibutyl-2H-triazole?
The canonical SMILES for 4,5-dibutyl-2H-triazole is CCCCc1n[nH]nc1CCCC.
What is the InChIKey of 4,5-dibutyl-2H-triazole?
The InChIKey is PLPYSSVNSLXRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-3-5-7-9-10(8-6-4-2)12-13-11-9/h3-8H2,1-2H3,(H,11,12,13).
What are the key properties of 4,5-dibutyl-2H-triazole?
4,5-dibutyl-2H-triazole has a molecular weight of 181.28 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibutyl-2H-triazole is sourced from PubChem (CID 54195681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).