About 2-(2-aminopropyl)phenol
2-(2-aminopropyl)phenol (PubChem CID 541960) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-(2-aminopropyl)phenol.
Molecular Properties
| Compound Name | 2-(2-aminopropyl)phenol |
| PubChem CID | 541960 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-(2-aminopropyl)phenol |
| SMILES | CC(N)Cc1ccccc1O |
| InChI | InChI=1S/C9H13NO/c1-7(10)6-8-4-2-3-5-9(8)11/h2-5,7,11H,6,10H2,1H3 |
| InChIKey | BCYNCBWCTHFJIU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-aminopropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminopropyl)phenol?
The IUPAC name of 2-(2-aminopropyl)phenol (CID 541960) is 2-(2-aminopropyl)phenol.
What is the SMILES notation for 2-(2-aminopropyl)phenol?
The canonical SMILES for 2-(2-aminopropyl)phenol is CC(N)Cc1ccccc1O.
What is the InChIKey of 2-(2-aminopropyl)phenol?
The InChIKey is BCYNCBWCTHFJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-7(10)6-8-4-2-3-5-9(8)11/h2-5,7,11H,6,10H2,1H3.
What are the key properties of 2-(2-aminopropyl)phenol?
2-(2-aminopropyl)phenol has a molecular weight of 151.21 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminopropyl)phenol is sourced from PubChem (CID 541960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).