C16H13N3O5S — CID 54196142
1-[4-(benzenesulfonyl)phenyl]-3-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 54196142) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)phenyl]-3-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[4-(benzenesulfonyl)phenyl]-3-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54196142 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-[4-(benzenesulfonyl)phenyl]-3-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)[nH]c(=O)n(-c2ccc(S(=O)(=O)c3ccccc3)cc2)c1=O |
| InChI | InChI=1S/C16H13N3O5S/c1-18-14(20)17-15(21)19(16(18)22)11-7-9-13(10-8-11)25(23,24)12-5-3-2-4-6-12/h2-10H,1H3,(H,17,20,21) |
| InChIKey | PLXZTUWWOONOAK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |