C8H12F6N2O — CID 54196179
1-(2,2,3,4,4,4-hexafluorobutyl)-1,3,3-trimethylurea (PubChem CID 54196179) has the molecular formula C8H12F6N2O and a molecular weight of 266.19 g/mol. Its IUPAC name is 1-(2,2,3,4,4,4-hexafluorobutyl)-1,3,3-trimethylurea.
| Compound Name | 1-(2,2,3,4,4,4-hexafluorobutyl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 54196179 |
| Molecular Formula | C8H12F6N2O |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-(2,2,3,4,4,4-hexafluorobutyl)-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)CC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6N2O/c1-15(2)6(17)16(3)4-7(10,11)5(9)8(12,13)14/h5H,4H2,1-3H3 |
| InChIKey | PLYTWWSFHMZZTR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |