C18H24O5 — CID 54196690
4-acetyl-2-hydroxy-2,6-bis(3-methylbut-2-enyl)cyclohexane-1,3,5-trione (PubChem CID 54196690) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-acetyl-2-hydroxy-2,6-bis(3-methylbut-2-enyl)cyclohexane-1,3,5-trione.
| Compound Name | 4-acetyl-2-hydroxy-2,6-bis(3-methylbut-2-enyl)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 54196690 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-acetyl-2-hydroxy-2,6-bis(3-methylbut-2-enyl)cyclohexane-1,3,5-trione |
| SMILES | CC(=O)C1C(=O)C(CC=C(C)C)C(=O)C(O)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C18H24O5/c1-10(2)6-7-13-15(20)14(12(5)19)17(22)18(23,16(13)21)9-8-11(3)4/h6,8,13-14,23H,7,9H2,1-5H3 |
| InChIKey | PMHVBXNEEMKVAZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|