About 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one
4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one (PubChem CID 54197102) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one.
Molecular Properties
| Compound Name | 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one |
| PubChem CID | 54197102 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one |
| SMILES | O=c1[nH]ncc2c1N=CCC2 |
| InChI | InChI=1S/C7H7N3O/c11-7-6-5(4-9-10-7)2-1-3-8-6/h3-4H,1-2H2,(H,10,11) |
| InChIKey | PMPHYPQXHMXTEP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one?
The IUPAC name of 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one (CID 54197102) is 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one.
What is the SMILES notation for 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one?
The canonical SMILES for 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one is O=c1[nH]ncc2c1N=CCC2.
What is the InChIKey of 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one?
The InChIKey is PMPHYPQXHMXTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c11-7-6-5(4-9-10-7)2-1-3-8-6/h3-4H,1-2H2,(H,10,11).
What are the key properties of 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one?
4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one has a molecular weight of 149.15 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-3H-pyrido[2,3-d]pyridazin-8-one is sourced from PubChem (CID 54197102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).