C14H10F5NO2S — CID 54197166
N,N-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)sulfonylaniline (PubChem CID 54197166) has the molecular formula C14H10F5NO2S and a molecular weight of 351.30 g/mol. Its IUPAC name is N,N-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)sulfonylaniline.
| Compound Name | N,N-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)sulfonylaniline |
|---|---|
| PubChem CID | 54197166 |
| Molecular Formula | C14H10F5NO2S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N,N-dimethyl-4-(2,3,4,5,6-pentafluorophenyl)sulfonylaniline |
| SMILES | CN(C)c1ccc(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H10F5NO2S/c1-20(2)7-3-5-8(6-4-7)23(21,22)14-12(18)10(16)9(15)11(17)13(14)19/h3-6H,1-2H3 |
| InChIKey | PMQKLSAUTBGFBG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|