C8H6F6O4S2 — CID 54197204
1,2-bis(trifluoromethylsulfonyl)hexa-1,3,5-triene (PubChem CID 54197204) has the molecular formula C8H6F6O4S2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 1,2-bis(trifluoromethylsulfonyl)hexa-1,3,5-triene.
| Compound Name | 1,2-bis(trifluoromethylsulfonyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 54197204 |
| Molecular Formula | C8H6F6O4S2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 1,2-bis(trifluoromethylsulfonyl)hexa-1,3,5-triene |
| SMILES | C=CC=CC(=CS(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H6F6O4S2/c1-2-3-4-6(20(17,18)8(12,13)14)5-19(15,16)7(9,10)11/h2-5H,1H2 |
| InChIKey | FKUHOLVMNWHZNE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|